DIETHYL 5-NITROISOPHTHALATE
diethyl 5-nitroisophthalate
CAS: 10560-13-1
Molecular Formula: C12H13NO6
DIETHYL 5-NITROISOPHTHALATE - Names and Identifiers
| Name | diethyl 5-nitroisophthalate |
| Synonyms | Einecs 234-144-2 DIETHYL 5-NITROISOPHTHALATE diethyl 5-nitroisophthalate Diethyl 5-nitroisophthalate diethyl 5-nitrobenzene-1,3-dicarboxylate diethyl 4-nitrobenzene-1,2-dicarboxylate 2,4-diethyl-5-nitrobenzene-1,3-dicarboxylate 5-Nitro-1,3-benzenedicarboxylic acid diethyl ester 1,3-Benzenedicarboxylic acid, 5-nitro-, 1,3-diethyl ester |
| CAS | 10560-13-1 |
| EINECS | 234-144-2 |
| InChI | InChI=1/C12H13NO6/c1-3-18-11(14)9-6-5-8(13(16)17)7-10(9)12(15)19-4-2/h5-7H,3-4H2,1-2H3 |
DIETHYL 5-NITROISOPHTHALATE - Physico-chemical Properties
| Molecular Formula | C12H13NO6 |
| Molar Mass | 267.23 |
| Density | 1.272g/cm3 |
| Boling Point | 369.9°C at 760 mmHg |
| Flash Point | 154.6°C |
| Vapor Presure | 1.15E-05mmHg at 25°C |
| Refractive Index | 1.537 |
DIETHYL 5-NITROISOPHTHALATE - Introduction
Diethyl 5-nitroisophthalate, chemical formula C12H14N2O8, is also known as diethyl 5-nitroisophthalate or DNPOA.
Nature:
1. Appearance: Colorless to yellow crystalline solid.
2. melting point: 96-100 ℃.
3. Boiling point: 380 ℃.
4. density: 1.35g/cm³.
5. Solubility: Soluble in alcohol and ether solvents, insoluble in water.
Use:
1. DNPOA is mainly used for dyes and intermediates in the pharmaceutical industry.
2. It can also be used as a starting material for the synthesis of high-energy compounds.
Preparation Method:
The synthesis of DNPOA is usually carried out by nitro reaction. Diethyl phthalate can be reacted with nitric acid under suitable conditions to produce diethyl 5-nitroisophthalate.
Safety Information:
1. DNPOA is a combustible, avoid contact with fire.
2. in the process of handling and storage, need to take appropriate protective measures.
3. avoid inhalation of its dust and avoid skin contact.
4. During use, use appropriate ventilation equipment and wear personal protective equipment, such as gloves and protective glasses.
5. If an accident occurs, flush the affected area with plenty of water immediately and seek medical help.
Nature:
1. Appearance: Colorless to yellow crystalline solid.
2. melting point: 96-100 ℃.
3. Boiling point: 380 ℃.
4. density: 1.35g/cm³.
5. Solubility: Soluble in alcohol and ether solvents, insoluble in water.
Use:
1. DNPOA is mainly used for dyes and intermediates in the pharmaceutical industry.
2. It can also be used as a starting material for the synthesis of high-energy compounds.
Preparation Method:
The synthesis of DNPOA is usually carried out by nitro reaction. Diethyl phthalate can be reacted with nitric acid under suitable conditions to produce diethyl 5-nitroisophthalate.
Safety Information:
1. DNPOA is a combustible, avoid contact with fire.
2. in the process of handling and storage, need to take appropriate protective measures.
3. avoid inhalation of its dust and avoid skin contact.
4. During use, use appropriate ventilation equipment and wear personal protective equipment, such as gloves and protective glasses.
5. If an accident occurs, flush the affected area with plenty of water immediately and seek medical help.
Last Update：2024-04-10 22:29:15
